C19H26ClN3O2 — CID 119144858
N'-[(5-chloro-2-methoxyphenyl)methyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119144858) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is N'-[(5-chloro-2-methoxyphenyl)methyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N'-[(5-chloro-2-methoxyphenyl)methyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119144858 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N'-[(5-chloro-2-methoxyphenyl)methyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc(Cl)ccc1OC)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C19H26ClN3O2/c1-3-21-19(22-9-12-8-13(20)4-5-16(12)24-2)23-10-14-15(11-23)18-7-6-17(14)25-18/h4-5,8,14-15,17-18H,3,6-7,9-11H2,1-2H3,(H,21,22) |
| InChIKey | VWYADLBIZBUREG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|