C20H29ClIN3O2 — CID 119156434
N'-[2-(3-chlorophenyl)-2-methoxyethyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide (PubChem CID 119156434) has the molecular formula C20H29ClIN3O2 and a molecular weight of 505.83 g/mol. Its IUPAC name is N'-[2-(3-chlorophenyl)-2-methoxyethyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(3-chlorophenyl)-2-methoxyethyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119156434 |
| Molecular Formula | C20H29ClIN3O2 |
| Molecular Weight | 505.83 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | N'-[2-(3-chlorophenyl)-2-methoxyethyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(OC)c1cccc(Cl)c1)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C20H28ClN3O2.HI/c1-3-22-20(23-10-19(25-2)13-5-4-6-14(21)9-13)24-11-15-16(12-24)18-8-7-17(15)26-18;/h4-6,9,15-19H,3,7-8,10-12H2,1-2H3,(H,22,23);1H |
| InChIKey | LCEVZWPIZZOXTJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.83 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|