C13H21ClIN3O — CID 111821692
2-[2-(3-chlorophenyl)-2-methoxyethyl]-1-propylguanidine;hydroiodide (PubChem CID 111821692) has the molecular formula C13H21ClIN3O and a molecular weight of 397.69 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-2-methoxyethyl]-1-propylguanidine;hydroiodide.
| Compound Name | 2-[2-(3-chlorophenyl)-2-methoxyethyl]-1-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111821692 |
| Molecular Formula | C13H21ClIN3O |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-2-methoxyethyl]-1-propylguanidine;hydroiodide |
| SMILES | CCCN/C(N)=N/CC(OC)c1cccc(Cl)c1.I |
| InChI | InChI=1S/C13H20ClN3O.HI/c1-3-7-16-13(15)17-9-12(18-2)10-5-4-6-11(14)8-10;/h4-6,8,12H,3,7,9H2,1-2H3,(H3,15,16,17);1H |
| InChIKey | XHXQCOFDHGHDOM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|