C15H24IN5O — CID 119144299
N'-methyl-N-[(1-methylpyrazol-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide (PubChem CID 119144299) has the molecular formula C15H24IN5O and a molecular weight of 417.30 g/mol. Its IUPAC name is N'-methyl-N-[(1-methylpyrazol-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[(1-methylpyrazol-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119144299 |
| Molecular Formula | C15H24IN5O |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N'-methyl-N-[(1-methylpyrazol-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cnn(C)c1)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C15H23N5O.HI/c1-16-15(17-5-10-6-18-19(2)7-10)20-8-11-12(9-20)14-4-3-13(11)21-14;/h6-7,11-14H,3-5,8-9H2,1-2H3,(H,16,17);1H |
| InChIKey | RJSUFSGQVHAKGB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|