C17H21BrFN3O — CID 119144746
N-[(3-bromo-5-fluorophenyl)methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119144746) has the molecular formula C17H21BrFN3O and a molecular weight of 382.28 g/mol. Its IUPAC name is N-[(3-bromo-5-fluorophenyl)methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N-[(3-bromo-5-fluorophenyl)methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119144746 |
| Molecular Formula | C17H21BrFN3O |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[(3-bromo-5-fluorophenyl)methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | C/N=C(\NCc1cc(F)cc(Br)c1)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C17H21BrFN3O/c1-20-17(21-7-10-4-11(18)6-12(19)5-10)22-8-13-14(9-22)16-3-2-15(13)23-16/h4-6,13-16H,2-3,7-9H2,1H3,(H,20,21) |
| InChIKey | PNRXIGCADLCESJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|