C14H25N5 — CID 111153617
N',3,5-trimethyl-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1-carboximidamide (PubChem CID 111153617) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is N',3,5-trimethyl-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | N',3,5-trimethyl-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111153617 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | N',3,5-trimethyl-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cnn(C)c1)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C14H25N5/c1-11-5-12(2)9-19(8-11)14(15-3)16-6-13-7-17-18(4)10-13/h7,10-12H,5-6,8-9H2,1-4H3,(H,15,16) |
| InChIKey | TVAFPRAOPIJCBF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|