C16H27N3O4 — CID 111605281
methyl 5-[[[ethylamino-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 111605281) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[[ethylamino-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 111605281 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | methyl 5-[[[ethylamino-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | CCN/C(=N\Cc1cc(C(=O)OC)c(C)o1)NCC(C)(C)OC |
| InChI | InChI=1S/C16H27N3O4/c1-7-17-15(19-10-16(3,4)22-6)18-9-12-8-13(11(2)23-12)14(20)21-5/h8H,7,9-10H2,1-6H3,(H2,17,18,19) |
| InChIKey | FZVMTMBZPHGFQU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|