C19H29IN4O4 — CID 111592590
methyl 5-[[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide (PubChem CID 111592590) has the molecular formula C19H29IN4O4 and a molecular weight of 504.37 g/mol. Its IUPAC name is methyl 5-[[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide.
| Compound Name | methyl 5-[[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111592590 |
| Molecular Formula | C19H29IN4O4 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | methyl 5-[[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(=O)OC)c(C)o1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C19H28N4O4.HI/c1-7-20-18(23-11-16-21-10-15(27-16)19(3,4)5)22-9-13-8-14(12(2)26-13)17(24)25-6;/h8,10H,7,9,11H2,1-6H3,(H2,20,22,23);1H |
| InChIKey | WJOVQXFTAPEQEA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|