C16H30IN5O2 — CID 111595547
2-[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]-N-propylacetamide;hydroiodide (PubChem CID 111595547) has the molecular formula C16H30IN5O2 and a molecular weight of 451.35 g/mol. Its IUPAC name is 2-[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]-N-propylacetamide;hydroiodide.
| Compound Name | 2-[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]-N-propylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111595547 |
| Molecular Formula | C16H30IN5O2 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-[[[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]-N-propylacetamide;hydroiodide |
| SMILES | CCCNC(=O)C/N=C(\NCC)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C16H29N5O2.HI/c1-6-8-18-13(22)10-20-15(17-7-2)21-11-14-19-9-12(23-14)16(3,4)5;/h9H,6-8,10-11H2,1-5H3,(H,18,22)(H2,17,20,21);1H |
| InChIKey | UAEWAJWWDOQDHM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|