C20H34IN3O4 — CID 111575254
methyl 5-[[[(2-cycloheptyloxyethylamino)-(ethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide (PubChem CID 111575254) has the molecular formula C20H34IN3O4 and a molecular weight of 507.41 g/mol. Its IUPAC name is methyl 5-[[[(2-cycloheptyloxyethylamino)-(ethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide.
| Compound Name | methyl 5-[[[(2-cycloheptyloxyethylamino)-(ethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111575254 |
| Molecular Formula | C20H34IN3O4 |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | methyl 5-[[[(2-cycloheptyloxyethylamino)-(ethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(=O)OC)c(C)o1)NCCOC1CCCCCC1.I |
| InChI | InChI=1S/C20H33N3O4.HI/c1-4-21-20(22-11-12-26-16-9-7-5-6-8-10-16)23-14-17-13-18(15(2)27-17)19(24)25-3;/h13,16H,4-12,14H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | DCQQJVWFEQTHOA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|