C22H36IN3O5 — CID 109448592
methyl 5-[[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide (PubChem CID 109448592) has the molecular formula C22H36IN3O5 and a molecular weight of 549.45 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide.
| Compound Name | methyl 5-[[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109448592 |
| Molecular Formula | C22H36IN3O5 |
| Molecular Weight | 549.45 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | methyl 5-[[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(=O)OC)c(C)o1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C22H35N3O5.HI/c1-4-23-22(24-14-19-13-20(16(2)30-19)21(26)27-3)25-10-8-17(9-11-25)29-15-18-7-5-6-12-28-18;/h13,17-18H,4-12,14-15H2,1-3H3,(H,23,24);1H |
| InChIKey | ZDDPNSNNIDDBCQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|