C19H31IN4O4 — CID 111728372
methyl 5-[[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide (PubChem CID 111728372) has the molecular formula C19H31IN4O4 and a molecular weight of 506.39 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide.
| Compound Name | methyl 5-[[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111728372 |
| Molecular Formula | C19H31IN4O4 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | methyl 5-[[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(=O)OC)c(C)o1)N1CCC(N2CCOCC2)C1.I |
| InChI | InChI=1S/C19H30N4O4.HI/c1-4-20-19(21-12-16-11-17(14(2)27-16)18(24)25-3)23-6-5-15(13-23)22-7-9-26-10-8-22;/h11,15H,4-10,12-13H2,1-3H3,(H,20,21);1H |
| InChIKey | CZQNZSSWSCNMPY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|