C24H41IN4O2 — CID 109450266
N'-[[4-(dimethylamino)-2-methylphenyl]methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109450266) has the molecular formula C24H41IN4O2 and a molecular weight of 544.52 g/mol. Its IUPAC name is N'-[[4-(dimethylamino)-2-methylphenyl]methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(dimethylamino)-2-methylphenyl]methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109450266 |
| Molecular Formula | C24H41IN4O2 |
| Molecular Weight | 544.52 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | N'-[[4-(dimethylamino)-2-methylphenyl]methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N(C)C)cc1C)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C24H40N4O2.HI/c1-5-25-24(26-17-20-9-10-21(27(3)4)16-19(20)2)28-13-11-22(12-14-28)30-18-23-8-6-7-15-29-23;/h9-10,16,22-23H,5-8,11-15,17-18H2,1-4H3,(H,25,26);1H |
| InChIKey | YWTWEDXOSVPBAO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|