C24H36N4O — CID 111744424
N'-methyl-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]-2-azaspiro[4.5]decane-2-carboximidamide (PubChem CID 111744424) has the molecular formula C24H36N4O and a molecular weight of 396.58 g/mol. Its IUPAC name is N'-methyl-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]-2-azaspiro[4.5]decane-2-carboximidamide.
| Compound Name | N'-methyl-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]-2-azaspiro[4.5]decane-2-carboximidamide |
|---|---|
| PubChem CID | 111744424 |
| Molecular Formula | C24H36N4O |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | N'-methyl-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]-2-azaspiro[4.5]decane-2-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N2CCCCC2)cc1)N1CCC2(CCCCC2)C1 |
| InChI | InChI=1S/C24H36N4O/c1-25-23(28-17-14-24(19-28)12-4-2-5-13-24)26-18-20-8-10-21(11-9-20)22(29)27-15-6-3-7-16-27/h8-11H,2-7,12-19H2,1H3,(H,25,26) |
| InChIKey | CQHGKBZSUQURMK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|