C21H32FIN4O — CID 109442496
N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide (PubChem CID 109442496) has the molecular formula C21H32FIN4O and a molecular weight of 502.42 g/mol. Its IUPAC name is N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109442496 |
| Molecular Formula | C21H32FIN4O |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(N2CCOCC2)c(F)c1)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C21H31FN4O.HI/c1-23-21(26-14-17-4-2-3-5-18(17)15-26)24-13-16-6-7-20(19(22)12-16)25-8-10-27-11-9-25;/h6-7,12,17-18H,2-5,8-11,13-15H2,1H3,(H,23,24);1H |
| InChIKey | PLFQSPITFYIPCX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|