C22H36IN5O2 — CID 111253386
methyl 1-[N'-methyl-N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111253386) has the molecular formula C22H36IN5O2 and a molecular weight of 529.47 g/mol. Its IUPAC name is methyl 1-[N'-methyl-N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-methyl-N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111253386 |
| Molecular Formula | C22H36IN5O2 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | methyl 1-[N'-methyl-N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(CN2CCN(C)CC2)cc1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C22H35N5O2.HI/c1-23-22(27-10-8-20(9-11-27)21(28)29-3)24-16-18-4-6-19(7-5-18)17-26-14-12-25(2)13-15-26;/h4-7,20H,8-17H2,1-3H3,(H,23,24);1H |
| InChIKey | AKCBIEOLXLSNPO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|