C24H28IN5O2 — CID 111910606
N-[4-[[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111910606) has the molecular formula C24H28IN5O2 and a molecular weight of 545.43 g/mol. Its IUPAC name is N-[4-[[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[4-[[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111910606 |
| Molecular Formula | C24H28IN5O2 |
| Molecular Weight | 545.43 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | N-[4-[[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(NC(=O)c2ccco2)cc1)NC1CCN(c2ccccc2)C1.I |
| InChI | InChI=1S/C24H27N5O2.HI/c1-25-24(28-20-13-14-29(17-20)21-6-3-2-4-7-21)26-16-18-9-11-19(12-10-18)27-23(30)22-8-5-15-31-22;/h2-12,15,20H,13-14,16-17H2,1H3,(H,27,30)(H2,25,26,28);1H |
| InChIKey | PHTNTDZLAUBHMC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|