C22H24F3N5 — CID 111421079
2-methyl-1-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111421079) has the molecular formula C22H24F3N5 and a molecular weight of 415.46 g/mol. Its IUPAC name is 2-methyl-1-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111421079 |
| Molecular Formula | C22H24F3N5 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-methyl-1-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(C(F)(F)F)cc1)NCc1cccc(Cn2ccnc2C)c1 |
| InChI | InChI=1S/C22H24F3N5/c1-16-27-10-11-30(16)15-19-5-3-4-18(12-19)14-29-21(26-2)28-13-17-6-8-20(9-7-17)22(23,24)25/h3-12H,13-15H2,1-2H3,(H2,26,28,29) |
| InChIKey | BUMOHNOBFVHQNS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|