C22H33IN4O2S — CID 111010990
1-[2-(benzenesulfonyl)ethyl]-3-[2-(diethylamino)-2-phenylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111010990) has the molecular formula C22H33IN4O2S and a molecular weight of 544.50 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-3-[2-(diethylamino)-2-phenylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-3-[2-(diethylamino)-2-phenylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111010990 |
| Molecular Formula | C22H33IN4O2S |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-3-[2-(diethylamino)-2-phenylethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)C(CN/C(=N\C)NCCS(=O)(=O)c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C22H32N4O2S.HI/c1-4-26(5-2)21(19-12-8-6-9-13-19)18-25-22(23-3)24-16-17-29(27,28)20-14-10-7-11-15-20;/h6-15,21H,4-5,16-18H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | BBOIYVVPZFIYOF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|