C22H34IN5O2S — CID 111011070
1-[2-(diethylamino)-2-phenylethyl]-2-methyl-3-[[4-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111011070) has the molecular formula C22H34IN5O2S and a molecular weight of 559.52 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-phenylethyl]-2-methyl-3-[[4-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(diethylamino)-2-phenylethyl]-2-methyl-3-[[4-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111011070 |
| Molecular Formula | C22H34IN5O2S |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 1-[2-(diethylamino)-2-phenylethyl]-2-methyl-3-[[4-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN(CC)C(CN/C(=N\C)NCc1ccc(S(=O)(=O)NC)cc1)c1ccccc1.I |
| InChI | InChI=1S/C22H33N5O2S.HI/c1-5-27(6-2)21(19-10-8-7-9-11-19)17-26-22(23-3)25-16-18-12-14-20(15-13-18)30(28,29)24-4;/h7-15,21,24H,5-6,16-17H2,1-4H3,(H2,23,25,26);1H |
| InChIKey | ZSFHHGWLUOVJEN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|