C17H22FN3O2S2 — CID 109446447
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine (PubChem CID 109446447) has the molecular formula C17H22FN3O2S2 and a molecular weight of 383.51 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109446447 |
| Molecular Formula | C17H22FN3O2S2 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cc(F)ccc1CS(C)(=O)=O)NCc1sccc1C |
| InChI | InChI=1S/C17H22FN3O2S2/c1-12-6-7-24-16(12)10-21-17(19-2)20-9-14-8-15(18)5-4-13(14)11-25(3,22)23/h4-8H,9-11H2,1-3H3,(H2,19,20,21) |
| InChIKey | CWMGICJNPUFRKL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|