C18H23FN4O2S — CID 109446015
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[(6-methyl-2-pyridinyl)methyl]guanidine (PubChem CID 109446015) has the molecular formula C18H23FN4O2S and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[(6-methyl-2-pyridinyl)methyl]guanidine.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[(6-methyl-2-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 109446015 |
| Molecular Formula | C18H23FN4O2S |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[(6-methyl-2-pyridinyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cccc(C)n1)NCc1cc(F)ccc1CS(C)(=O)=O |
| InChI | InChI=1S/C18H23FN4O2S/c1-13-5-4-6-17(23-13)11-22-18(20-2)21-10-15-9-16(19)8-7-14(15)12-26(3,24)25/h4-9H,10-12H2,1-3H3,(H2,20,21,22) |
| InChIKey | SZFAMKMSHNCOGX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|