C19H28FIN4O2S2 — CID 109445734
1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 109445734) has the molecular formula C19H28FIN4O2S2 and a molecular weight of 554.50 g/mol. Its IUPAC name is 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109445734 |
| Molecular Formula | C19H28FIN4O2S2 |
| Molecular Weight | 554.50 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nc(CCN/C(=N\C)NCc2cc(F)ccc2CS(C)(=O)=O)sc1C.I |
| InChI | InChI=1S/C19H27FN4O2S2.HI/c1-5-17-13(2)27-18(24-17)8-9-22-19(21-3)23-11-15-10-16(20)7-6-14(15)12-28(4,25)26;/h6-7,10H,5,8-9,11-12H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | FCOBUGHOKLGEGF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|