C18H25FN4S — CID 111395221
1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111395221) has the molecular formula C18H25FN4S and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111395221 |
| Molecular Formula | C18H25FN4S |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine |
| SMILES | CCc1nc(CCN/C(=N\C)NCCc2cccc(F)c2)sc1C |
| InChI | InChI=1S/C18H25FN4S/c1-4-16-13(2)24-17(23-16)9-11-22-18(20-3)21-10-8-14-6-5-7-15(19)12-14/h5-7,12H,4,8-11H2,1-3H3,(H2,20,21,22) |
| InChIKey | YZPRLQIVUUXOBR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|