C21H23FN4O3S — CID 109444441
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine (PubChem CID 109444441) has the molecular formula C21H23FN4O3S and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109444441 |
| Molecular Formula | C21H23FN4O3S |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cc(-c2ccccc2)on1)NCc1cc(F)ccc1CS(C)(=O)=O |
| InChI | InChI=1S/C21H23FN4O3S/c1-23-21(24-12-17-10-18(22)9-8-16(17)14-30(2,27)28)25-13-19-11-20(29-26-19)15-6-4-3-5-7-15/h3-11H,12-14H2,1-2H3,(H2,23,24,25) |
| InChIKey | CEIMQOINCVXICX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|