C12H21I2N3S — CID 111181210
1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-(2-methylpropyl)guanidine;hydroiodide (PubChem CID 111181210) has the molecular formula C12H21I2N3S and a molecular weight of 493.20 g/mol. Its IUPAC name is 1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-(2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-(2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111181210 |
| Molecular Formula | C12H21I2N3S |
| Molecular Weight | 493.20 g/mol |
| Exact Mass | 492.95 |
| IUPAC Name | 1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-(2-methylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(I)s1)NCC(C)C.I |
| InChI | InChI=1S/C12H20IN3S.HI/c1-9(2)8-16-12(14-3)15-7-6-10-4-5-11(13)17-10;/h4-5,9H,6-8H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | ISPVUALOCGOFMA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.20 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|