C14H23I2N3S2 — CID 111529102
1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 111529102) has the molecular formula C14H23I2N3S2 and a molecular weight of 551.30 g/mol. Its IUPAC name is 1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111529102 |
| Molecular Formula | C14H23I2N3S2 |
| Molecular Weight | 551.30 g/mol |
| Exact Mass | 550.94 |
| IUPAC Name | 1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(I)s1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C14H22IN3S2.HI/c1-16-14(18-10-3-4-12(9-10)19-2)17-8-7-11-5-6-13(15)20-11;/h5-6,10,12H,3-4,7-9H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | GLLXNWBEVZBBLL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|