C16H23F2N3S — CID 111530055
1-[2-(2,6-difluorophenyl)ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine (PubChem CID 111530055) has the molecular formula C16H23F2N3S and a molecular weight of 327.44 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine.
| Compound Name | 1-[2-(2,6-difluorophenyl)ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine |
|---|---|
| PubChem CID | 111530055 |
| Molecular Formula | C16H23F2N3S |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine |
| SMILES | C/N=C(\NCCc1c(F)cccc1F)NC1CCC(SC)C1 |
| InChI | InChI=1S/C16H23F2N3S/c1-19-16(21-11-6-7-12(10-11)22-2)20-9-8-13-14(17)4-3-5-15(13)18/h3-5,11-12H,6-10H2,1-2H3,(H2,19,20,21) |
| InChIKey | MBLAIQOUTBEQCX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|