C17H28FIN4O2S2 — CID 111529032
1-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 111529032) has the molecular formula C17H28FIN4O2S2 and a molecular weight of 530.47 g/mol. Its IUPAC name is 1-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 1-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111529032 |
| Molecular Formula | C17H28FIN4O2S2 |
| Molecular Weight | 530.47 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | 1-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)Nc1ccc(C)c(F)c1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C17H27FN4O2S2.HI/c1-12-4-5-14(11-16(12)18)22-26(23,24)9-8-20-17(19-2)21-13-6-7-15(10-13)25-3;/h4-5,11,13,15,22H,6-10H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | LFVJYMMGOXBZGG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|