C17H29FN4O2S — CID 111890601
1-(2-ethylbutyl)-3-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-methylguanidine (PubChem CID 111890601) has the molecular formula C17H29FN4O2S and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-(2-ethylbutyl)-3-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-methylguanidine.
| Compound Name | 1-(2-ethylbutyl)-3-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111890601 |
| Molecular Formula | C17H29FN4O2S |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-(2-ethylbutyl)-3-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-methylguanidine |
| SMILES | CCC(CC)CN/C(=N\C)NCCS(=O)(=O)Nc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C17H29FN4O2S/c1-5-14(6-2)12-21-17(19-4)20-9-10-25(23,24)22-15-8-7-13(3)16(18)11-15/h7-8,11,14,22H,5-6,9-10,12H2,1-4H3,(H2,19,20,21) |
| InChIKey | VEIFYHNZIGLWOI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|