C17H30FIN4O2S — CID 110977776
1-ethyl-3-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-(3-methylbutyl)guanidine;hydroiodide (PubChem CID 110977776) has the molecular formula C17H30FIN4O2S and a molecular weight of 500.42 g/mol. Its IUPAC name is 1-ethyl-3-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-(3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-(3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110977776 |
| Molecular Formula | C17H30FIN4O2S |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 1-ethyl-3-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-(3-methylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(C)C)NCCS(=O)(=O)Nc1ccc(C)c(F)c1.I |
| InChI | InChI=1S/C17H29FN4O2S.HI/c1-5-19-17(20-9-8-13(2)3)21-10-11-25(23,24)22-15-7-6-14(4)16(18)12-15;/h6-7,12-13,22H,5,8-11H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | WLDNWVZYYXKXOL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|