C16H25FN4O3S — CID 111137705
1-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine (PubChem CID 111137705) has the molecular formula C16H25FN4O3S and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111137705 |
| Molecular Formula | C16H25FN4O3S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCS(=O)(=O)Nc1ccc(C)c(F)c1)NCC1CCCO1 |
| InChI | InChI=1S/C16H25FN4O3S/c1-12-5-6-13(10-15(12)17)21-25(22,23)9-7-19-16(18-2)20-11-14-4-3-8-24-14/h5-6,10,14,21H,3-4,7-9,11H2,1-2H3,(H2,18,19,20) |
| InChIKey | FOUAKUYTUBZQNT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|