C15H22F2IN3O — CID 111780840
1-[2-(2,4-difluorophenyl)ethyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111780840) has the molecular formula C15H22F2IN3O and a molecular weight of 425.26 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenyl)ethyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,4-difluorophenyl)ethyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111780840 |
| Molecular Formula | C15H22F2IN3O |
| Molecular Weight | 425.26 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 1-[2-(2,4-difluorophenyl)ethyl]-2-methyl-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(F)cc1F)NCC1CCCO1.I |
| InChI | InChI=1S/C15H21F2N3O.HI/c1-18-15(20-10-13-3-2-8-21-13)19-7-6-11-4-5-12(16)9-14(11)17;/h4-5,9,13H,2-3,6-8,10H2,1H3,(H2,18,19,20);1H |
| InChIKey | RUTSQWYVLCZMJD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|