C18H27F2N3O2S — CID 111528677
1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine (PubChem CID 111528677) has the molecular formula C18H27F2N3O2S and a molecular weight of 387.50 g/mol. Its IUPAC name is 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine.
| Compound Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine |
|---|---|
| PubChem CID | 111528677 |
| Molecular Formula | C18H27F2N3O2S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine |
| SMILES | C/N=C(\NCCc1ccc(OC)c(OC(F)F)c1)NC1CCC(SC)C1 |
| InChI | InChI=1S/C18H27F2N3O2S/c1-21-18(23-13-5-6-14(11-13)26-3)22-9-8-12-4-7-15(24-2)16(10-12)25-17(19)20/h4,7,10,13-14,17H,5-6,8-9,11H2,1-3H3,(H2,21,22,23) |
| InChIKey | HAGLOIIGJKVFKD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|