C15H17ClF2N4O3S2 — CID 111708925
1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111708925) has the molecular formula C15H17ClF2N4O3S2 and a molecular weight of 438.91 g/mol. Its IUPAC name is 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111708925 |
| Molecular Formula | C15H17ClF2N4O3S2 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(S(N)(=O)=O)s1)NCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C15H17ClF2N4O3S2/c1-20-15(22-8-11-3-5-13(26-11)27(19,23)24)21-7-9-6-10(16)2-4-12(9)25-14(17)18/h2-6,14H,7-8H2,1H3,(H2,19,23,24)(H2,20,21,22) |
| InChIKey | MJICHNPRPXLJQI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|