C16H20F3IN4O2S2 — CID 111295244
2-methyl-1-[(5-sulfamoylthiophen-2-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111295244) has the molecular formula C16H20F3IN4O2S2 and a molecular weight of 548.39 g/mol. Its IUPAC name is 2-methyl-1-[(5-sulfamoylthiophen-2-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-sulfamoylthiophen-2-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111295244 |
| Molecular Formula | C16H20F3IN4O2S2 |
| Molecular Weight | 548.39 g/mol |
| Exact Mass | 548.00 |
| IUPAC Name | 2-methyl-1-[(5-sulfamoylthiophen-2-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(C(F)(F)F)cc1)NCc1ccc(S(N)(=O)=O)s1.I |
| InChI | InChI=1S/C16H19F3N4O2S2.HI/c1-21-15(23-10-13-6-7-14(26-13)27(20,24)25)22-9-8-11-2-4-12(5-3-11)16(17,18)19;/h2-7H,8-10H2,1H3,(H2,20,24,25)(H2,21,22,23);1H |
| InChIKey | PCBMUKPXMIDVGI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|