C18H22F4IN5OS — CID 111889744
N-[2-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111889744) has the molecular formula C18H22F4IN5OS and a molecular weight of 559.37 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111889744 |
| Molecular Formula | C18H22F4IN5OS |
| Molecular Weight | 559.37 g/mol |
| Exact Mass | 559.05 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1C(F)(F)F)NCCNC(=O)c1scnc1C.I |
| InChI | InChI=1S/C18H21F4N5OS.HI/c1-3-23-17(25-7-6-24-16(28)15-11(2)27-10-29-15)26-9-12-4-5-13(19)8-14(12)18(20,21)22;/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,24,28)(H2,23,25,26);1H |
| InChIKey | PXRNRILPPXAMBJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|