C15H22IN5O2S — CID 110938565
N-[2-[[N-ethyl-N'-(furan-2-ylmethyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 110938565) has the molecular formula C15H22IN5O2S and a molecular weight of 463.35 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(furan-2-ylmethyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-(furan-2-ylmethyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 110938565 |
| Molecular Formula | C15H22IN5O2S |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(furan-2-ylmethyl)carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCCNC(=O)c1scnc1C.I |
| InChI | InChI=1S/C15H21N5O2S.HI/c1-3-16-15(19-9-12-5-4-8-22-12)18-7-6-17-14(21)13-11(2)20-10-23-13;/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,17,21)(H2,16,18,19);1H |
| InChIKey | RFPISYCFAGSRBK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|