C19H29F3N4O2 — CID 111694670
N-ethyl-2-[[N-ethyl-N'-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide (PubChem CID 111694670) has the molecular formula C19H29F3N4O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-ethyl-2-[[N-ethyl-N'-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-ethyl-2-[[N-ethyl-N'-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111694670 |
| Molecular Formula | C19H29F3N4O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | N-ethyl-2-[[N-ethyl-N'-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
| SMILES | CCNC(=O)CN/C(=N/Cc1ccc(OC(C)(C)C)cc1C(F)(F)F)NCC |
| InChI | InChI=1S/C19H29F3N4O2/c1-6-23-16(27)12-26-17(24-7-2)25-11-13-8-9-14(28-18(3,4)5)10-15(13)19(20,21)22/h8-10H,6-7,11-12H2,1-5H3,(H,23,27)(H2,24,25,26) |
| InChIKey | HFQJFNFUULHCSC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|