C19H30F3N3O3S — CID 111694636
1-ethyl-2-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-3-(3-methylsulfonylpropyl)guanidine (PubChem CID 111694636) has the molecular formula C19H30F3N3O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 1-ethyl-2-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-3-(3-methylsulfonylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-3-(3-methylsulfonylpropyl)guanidine |
|---|---|
| PubChem CID | 111694636 |
| Molecular Formula | C19H30F3N3O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 1-ethyl-2-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-3-(3-methylsulfonylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC(C)(C)C)cc1C(F)(F)F)NCCCS(C)(=O)=O |
| InChI | InChI=1S/C19H30F3N3O3S/c1-6-23-17(24-10-7-11-29(5,26)27)25-13-14-8-9-15(28-18(2,3)4)12-16(14)19(20,21)22/h8-9,12H,6-7,10-11,13H2,1-5H3,(H2,23,24,25) |
| InChIKey | JZMKEYYAKUSHSF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|