C20H29F3N6O — CID 111694800
1-ethyl-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111694800) has the molecular formula C20H29F3N6O and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-ethyl-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111694800 |
| Molecular Formula | C20H29F3N6O |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 1-ethyl-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC(C)(C)C)cc1C(F)(F)F)NCc1nncn1CC |
| InChI | InChI=1S/C20H29F3N6O/c1-6-24-18(26-12-17-28-27-13-29(17)7-2)25-11-14-8-9-15(30-19(3,4)5)10-16(14)20(21,22)23/h8-10,13H,6-7,11-12H2,1-5H3,(H2,24,25,26) |
| InChIKey | WWSAUEGNZNFJKM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|