C15H19ClF3N5 — CID 142720656
N'-[N'-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]piperidine-1-carboximidamide (PubChem CID 142720656) has the molecular formula C15H19ClF3N5 and a molecular weight of 361.80 g/mol. Its IUPAC name is N'-[N'-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]piperidine-1-carboximidamide.
| Compound Name | N'-[N'-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 142720656 |
| Molecular Formula | C15H19ClF3N5 |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N'-[N'-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N/C(N)=N/Cc1ccc(Cl)c(C(F)(F)F)c1)N1CCCCC1 |
| InChI | InChI=1S/C15H19ClF3N5/c16-12-5-4-10(8-11(12)15(17,18)19)9-22-13(20)23-14(21)24-6-2-1-3-7-24/h4-5,8H,1-3,6-7,9H2,(H4,20,21,22,23) |
| InChIKey | GXESNQQQGOSXAQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|