C15H19Cl3F3N5 — CID 142722489
N'-[N'-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]-3-methyl-2,5-dihydropyrrole-1-carboximidamide;dihydrochloride (PubChem CID 142722489) has the molecular formula C15H19Cl3F3N5 and a molecular weight of 432.71 g/mol. Its IUPAC name is N'-[N'-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]-3-methyl-2,5-dihydropyrrole-1-carboximidamide;dihydrochloride.
| Compound Name | N'-[N'-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]-3-methyl-2,5-dihydropyrrole-1-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 142722489 |
| Molecular Formula | C15H19Cl3F3N5 |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | N'-[N'-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]-3-methyl-2,5-dihydropyrrole-1-carboximidamide;dihydrochloride |
| SMILES | CC1=CCN(/C(N)=N\C(N)=N\Cc2ccc(Cl)c(C(F)(F)F)c2)C1.Cl.Cl |
| InChI | InChI=1S/C15H17ClF3N5.2ClH/c1-9-4-5-24(8-9)14(21)23-13(20)22-7-10-2-3-12(16)11(6-10)15(17,18)19;;/h2-4,6H,5,7-8H2,1H3,(H4,20,21,22,23);2*1H |
| InChIKey | LERKJIYXSBPXDX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|