C14H18Cl2F3N5 — CID 142722445
N'-[N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]-2,5-dihydropyrrole-1-carboximidamide;dihydrochloride (PubChem CID 142722445) has the molecular formula C14H18Cl2F3N5 and a molecular weight of 384.23 g/mol. Its IUPAC name is N'-[N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]-2,5-dihydropyrrole-1-carboximidamide;dihydrochloride.
| Compound Name | N'-[N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]-2,5-dihydropyrrole-1-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 142722445 |
| Molecular Formula | C14H18Cl2F3N5 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N'-[N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]-2,5-dihydropyrrole-1-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N/C(N)=N/Cc1cccc(C(F)(F)F)c1)N1CC=CC1 |
| InChI | InChI=1S/C14H16F3N5.2ClH/c15-14(16,17)11-5-3-4-10(8-11)9-20-12(18)21-13(19)22-6-1-2-7-22;;/h1-5,8H,6-7,9H2,(H4,18,19,20,21);2*1H |
| InChIKey | KKFCNPCFKCRKSQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|