C15H15N3O3 — CID 146707716
N-(1,3-benzodioxol-5-ylmethyl)-2-oxo-2-pyrrolidin-1-ylethanimidoyl cyanide (PubChem CID 146707716) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-oxo-2-pyrrolidin-1-ylethanimidoyl cyanide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-oxo-2-pyrrolidin-1-ylethanimidoyl cyanide |
|---|---|
| PubChem CID | 146707716 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-oxo-2-pyrrolidin-1-ylethanimidoyl cyanide |
| SMILES | N#C/C(=N\Cc1ccc2c(c1)OCO2)C(=O)N1CCCC1 |
| InChI | InChI=1S/C15H15N3O3/c16-8-12(15(19)18-5-1-2-6-18)17-9-11-3-4-13-14(7-11)21-10-20-13/h3-4,7H,1-2,5-6,9-10H2/b17-12+ |
| InChIKey | QZVQRWDDJUDPGX-SFQUDFHCSA-N |
| XLogP | 1.50 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|