C20H30IN3O5 — CID 110993234
ethyl 1-[N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N-ethylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993234) has the molecular formula C20H30IN3O5 and a molecular weight of 519.38 g/mol. Its IUPAC name is ethyl 1-[N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N-ethylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N-ethylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993234 |
| Molecular Formula | C20H30IN3O5 |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | ethyl 1-[N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N-ethylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCOc1ccc2c(c1)OCO2)N1CCCC(C(=O)OCC)C1.I |
| InChI | InChI=1S/C20H29N3O5.HI/c1-3-21-20(23-10-5-6-15(13-23)19(24)25-4-2)22-9-11-26-16-7-8-17-18(12-16)28-14-27-17;/h7-8,12,15H,3-6,9-11,13-14H2,1-2H3,(H,21,22);1H |
| InChIKey | MHAMAOYSCHCZKG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|