C21H33IN4O5 — CID 111728974
tert-butyl N-[1-[N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide (PubChem CID 111728974) has the molecular formula C21H33IN4O5 and a molecular weight of 548.42 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111728974 |
| Molecular Formula | C21H33IN4O5 |
| Molecular Weight | 548.42 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | tert-butyl N-[1-[N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCOc1ccc2c(c1)OCO2)N1CCC(NC(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C21H32N4O5.HI/c1-5-22-19(25-10-8-15(13-25)24-20(26)30-21(2,3)4)23-9-11-27-16-6-7-17-18(12-16)29-14-28-17;/h6-7,12,15H,5,8-11,13-14H2,1-4H3,(H,22,23)(H,24,26);1H |
| InChIKey | VKXOCYIVQBXJML-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|