C15H24ClN3O4 — CID 119820020
N-[2-(3,5-dimethoxyanilino)-2-oxoethyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119820020) has the molecular formula C15H24ClN3O4 and a molecular weight of 345.83 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyanilino)-2-oxoethyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[2-(3,5-dimethoxyanilino)-2-oxoethyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119820020 |
| Molecular Formula | C15H24ClN3O4 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[2-(3,5-dimethoxyanilino)-2-oxoethyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NCC(=O)Nc1cc(OC)cc(OC)c1.Cl |
| InChI | InChI=1S/C15H23N3O4.ClH/c1-16-6-4-5-14(19)17-10-15(20)18-11-7-12(21-2)9-13(8-11)22-3;/h7-9,16H,4-6,10H2,1-3H3,(H,17,19)(H,18,20);1H |
| InChIKey | ASDJNFLUBOQARO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|