C15H23NO5 — CID 103602252
N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-3-(4-methoxyphenoxy)propanamide (PubChem CID 103602252) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-3-(4-methoxyphenoxy)propanamide.
| Compound Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-3-(4-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 103602252 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-3-(4-methoxyphenoxy)propanamide |
| SMILES | CCC(CO)(CO)NC(=O)CCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H23NO5/c1-3-15(10-17,11-18)16-14(19)8-9-21-13-6-4-12(20-2)5-7-13/h4-7,17-18H,3,8-11H2,1-2H3,(H,16,19) |
| InChIKey | ZAJWNGBYGJWCCB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |