C15H22FNO4 — CID 103890959
4-(4-fluorophenoxy)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]butanamide (PubChem CID 103890959) has the molecular formula C15H22FNO4 and a molecular weight of 299.34 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]butanamide.
| Compound Name | 4-(4-fluorophenoxy)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]butanamide |
|---|---|
| PubChem CID | 103890959 |
| Molecular Formula | C15H22FNO4 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-(4-fluorophenoxy)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]butanamide |
| SMILES | CCC(CO)(CO)NC(=O)CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C15H22FNO4/c1-2-15(10-18,11-19)17-14(20)4-3-9-21-13-7-5-12(16)6-8-13/h5-8,18-19H,2-4,9-11H2,1H3,(H,17,20) |
| InChIKey | OLHJJIWGYMRQKT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|